C21H25Cl2NO2 — CID 2321616
(2S)-1-[bis(4-chlorophenyl)methoxy]-3-piperidin-1-ylpropan-2-ol (PubChem CID 2321616) has the molecular formula C21H25Cl2NO2 and a molecular weight of 394.34 g/mol. Its IUPAC name is (2S)-1-[bis(4-chlorophenyl)methoxy]-3-piperidin-1-ylpropan-2-ol.
| Compound Name | (2S)-1-[bis(4-chlorophenyl)methoxy]-3-piperidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 2321616 |
| Molecular Formula | C21H25Cl2NO2 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (2S)-1-[bis(4-chlorophenyl)methoxy]-3-piperidin-1-ylpropan-2-ol |
| SMILES | O[C@H](COC(c1ccc(Cl)cc1)c1ccc(Cl)cc1)CN1CCCCC1 |
| InChI | InChI=1S/C21H25Cl2NO2/c22-18-8-4-16(5-9-18)21(17-6-10-19(23)11-7-17)26-15-20(25)14-24-12-2-1-3-13-24/h4-11,20-21,25H,1-3,12-15H2/t20-/m0/s1 |
| InChIKey | MTHBBLOCKYFYHP-FQEVSTJZSA-N |
| XLogP | 4.95 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |