C17H26ClNO3 — CID 110891581
1-[1-(4-chlorophenyl)ethoxy]-3-[4-(hydroxymethyl)piperidin-1-yl]propan-2-ol (PubChem CID 110891581) has the molecular formula C17H26ClNO3 and a molecular weight of 327.85 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)ethoxy]-3-[4-(hydroxymethyl)piperidin-1-yl]propan-2-ol.
| Compound Name | 1-[1-(4-chlorophenyl)ethoxy]-3-[4-(hydroxymethyl)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 110891581 |
| Molecular Formula | C17H26ClNO3 |
| Molecular Weight | 327.85 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[1-(4-chlorophenyl)ethoxy]-3-[4-(hydroxymethyl)piperidin-1-yl]propan-2-ol |
| SMILES | CC(OCC(O)CN1CCC(CO)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H26ClNO3/c1-13(15-2-4-16(18)5-3-15)22-12-17(21)10-19-8-6-14(11-20)7-9-19/h2-5,13-14,17,20-21H,6-12H2,1H3 |
| InChIKey | RHRXURNBXDXBGJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.85 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |