C16H24ClNO3 — CID 110882740
1-[1-(4-chlorophenyl)ethoxy]-3-(2-methylmorpholin-4-yl)propan-2-ol (PubChem CID 110882740) has the molecular formula C16H24ClNO3 and a molecular weight of 313.82 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)ethoxy]-3-(2-methylmorpholin-4-yl)propan-2-ol.
| Compound Name | 1-[1-(4-chlorophenyl)ethoxy]-3-(2-methylmorpholin-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 110882740 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.82 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1-[1-(4-chlorophenyl)ethoxy]-3-(2-methylmorpholin-4-yl)propan-2-ol |
| SMILES | CC1CN(CC(O)COC(C)c2ccc(Cl)cc2)CCO1 |
| InChI | InChI=1S/C16H24ClNO3/c1-12-9-18(7-8-20-12)10-16(19)11-21-13(2)14-3-5-15(17)6-4-14/h3-6,12-13,16,19H,7-11H2,1-2H3 |
| InChIKey | CKBZGYBLDNGVPW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.82 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |