C21H26ClN3O6S — CID 51727678
(2S)-1-[(1R)-1-(4-chlorophenyl)ethoxy]-3-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]propan-2-ol (PubChem CID 51727678) has the molecular formula C21H26ClN3O6S and a molecular weight of 483.97 g/mol. Its IUPAC name is (2S)-1-[(1R)-1-(4-chlorophenyl)ethoxy]-3-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]propan-2-ol.
| Compound Name | (2S)-1-[(1R)-1-(4-chlorophenyl)ethoxy]-3-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 51727678 |
| Molecular Formula | C21H26ClN3O6S |
| Molecular Weight | 483.97 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | (2S)-1-[(1R)-1-(4-chlorophenyl)ethoxy]-3-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]propan-2-ol |
| SMILES | C[C@@H](OC[C@@H](O)CN1CCN(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H26ClN3O6S/c1-16(17-2-4-18(22)5-3-17)31-15-20(26)14-23-10-12-24(13-11-23)32(29,30)21-8-6-19(7-9-21)25(27)28/h2-9,16,20,26H,10-15H2,1H3/t16-,20+/m1/s1 |
| InChIKey | LGUQYHAGUZQSDY-UZLBHIALSA-N |
| XLogP | 2.69 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.97 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|