C16H25FN2O4S — CID 78782687
1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-propan-2-yloxypropan-2-ol (PubChem CID 78782687) has the molecular formula C16H25FN2O4S and a molecular weight of 360.45 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 78782687 |
| Molecular Formula | C16H25FN2O4S |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-propan-2-yloxypropan-2-ol |
| SMILES | CC(C)OCC(O)CN1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H25FN2O4S/c1-13(2)23-12-15(20)11-18-7-9-19(10-8-18)24(21,22)16-5-3-14(17)4-6-16/h3-6,13,15,20H,7-12H2,1-2H3 |
| InChIKey | IFHJTLLXFYYZRW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |