C18H23FN2O4S2 — CID 2998945
1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 2998945) has the molecular formula C18H23FN2O4S2 and a molecular weight of 414.52 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 2998945 |
| Molecular Formula | C18H23FN2O4S2 |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | O=S(=O)(c1ccc(F)cc1)N1CCN(CC(O)COCc2cccs2)CC1 |
| InChI | InChI=1S/C18H23FN2O4S2/c19-15-3-5-18(6-4-15)27(23,24)21-9-7-20(8-10-21)12-16(22)13-25-14-17-2-1-11-26-17/h1-6,11,16,22H,7-10,12-14H2 |
| InChIKey | ISOGSTJNAINYJJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |