C12H19NO3S — CID 2359827
(2R)-1-morpholin-4-yl-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 2359827) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is (2R)-1-morpholin-4-yl-3-(thiophen-2-ylmethoxy)propan-2-ol.
| Compound Name | (2R)-1-morpholin-4-yl-3-(thiophen-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 2359827 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (2R)-1-morpholin-4-yl-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | O[C@@H](COCc1cccs1)CN1CCOCC1 |
| InChI | InChI=1S/C12H19NO3S/c14-11(8-13-3-5-15-6-4-13)9-16-10-12-2-1-7-17-12/h1-2,7,11,14H,3-6,8-10H2/t11-/m1/s1 |
| InChIKey | PIZUGWKFLHENED-LLVKDONJSA-N |
| XLogP | 0.96 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |