C17H22N2O4S — CID 2359522
furan-2-yl-[4-[(2S)-2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]piperazin-1-yl]methanone (PubChem CID 2359522) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is furan-2-yl-[4-[(2S)-2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]piperazin-1-yl]methanone.
| Compound Name | furan-2-yl-[4-[(2S)-2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 2359522 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | furan-2-yl-[4-[(2S)-2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCN(C[C@H](O)COCc2cccs2)CC1 |
| InChI | InChI=1S/C17H22N2O4S/c20-14(12-22-13-15-3-2-10-24-15)11-18-5-7-19(8-6-18)17(21)16-4-1-9-23-16/h1-4,9-10,14,20H,5-8,11-13H2/t14-/m0/s1 |
| InChIKey | KBJIPXHGTSPNPX-AWEZNQCLSA-N |
| XLogP | 1.68 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |