C14H22N2O4 — CID 95347650
[4-[(2S)-3-ethoxy-2-hydroxypropyl]piperazin-1-yl]-(furan-2-yl)methanone (PubChem CID 95347650) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is [4-[(2S)-3-ethoxy-2-hydroxypropyl]piperazin-1-yl]-(furan-2-yl)methanone.
| Compound Name | [4-[(2S)-3-ethoxy-2-hydroxypropyl]piperazin-1-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 95347650 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | [4-[(2S)-3-ethoxy-2-hydroxypropyl]piperazin-1-yl]-(furan-2-yl)methanone |
| SMILES | CCOC[C@@H](O)CN1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C14H22N2O4/c1-2-19-11-12(17)10-15-5-7-16(8-6-15)14(18)13-4-3-9-20-13/h3-4,9,12,17H,2,5-8,10-11H2,1H3/t12-/m0/s1 |
| InChIKey | MDBGYXAQKYSULX-LBPRGKRZSA-N |
| XLogP | 0.43 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |