C17H26N2O4 — CID 56803154
[4-(3-ethoxy-2-hydroxypropyl)piperazin-1-yl]-[2-(furan-2-yl)cyclopropyl]methanone (PubChem CID 56803154) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is [4-(3-ethoxy-2-hydroxypropyl)piperazin-1-yl]-[2-(furan-2-yl)cyclopropyl]methanone.
| Compound Name | [4-(3-ethoxy-2-hydroxypropyl)piperazin-1-yl]-[2-(furan-2-yl)cyclopropyl]methanone |
|---|---|
| PubChem CID | 56803154 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | [4-(3-ethoxy-2-hydroxypropyl)piperazin-1-yl]-[2-(furan-2-yl)cyclopropyl]methanone |
| SMILES | CCOCC(O)CN1CCN(C(=O)C2CC2c2ccco2)CC1 |
| InChI | InChI=1S/C17H26N2O4/c1-2-22-12-13(20)11-18-5-7-19(8-6-18)17(21)15-10-14(15)16-4-3-9-23-16/h3-4,9,13-15,20H,2,5-8,10-12H2,1H3 |
| InChIKey | IOZDNWHMYFULSW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |