C18H24N2O3S — CID 110877541
4-[4-[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]piperazin-1-yl]phenol (PubChem CID 110877541) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 4-[4-[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]piperazin-1-yl]phenol.
| Compound Name | 4-[4-[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 110877541 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 4-[4-[2-hydroxy-3-(thiophen-2-ylmethoxy)propyl]piperazin-1-yl]phenol |
| SMILES | Oc1ccc(N2CCN(CC(O)COCc3cccs3)CC2)cc1 |
| InChI | InChI=1S/C18H24N2O3S/c21-16-5-3-15(4-6-16)20-9-7-19(8-10-20)12-17(22)13-23-14-18-2-1-11-24-18/h1-6,11,17,21-22H,7-10,12-14H2 |
| InChIKey | BQQKQIGMOPLDOA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |