C18H24N2O4 — CID 3744667
4-[4-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]piperazin-1-yl]phenol (PubChem CID 3744667) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 4-[4-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]piperazin-1-yl]phenol.
| Compound Name | 4-[4-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 3744667 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 4-[4-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]piperazin-1-yl]phenol |
| SMILES | Oc1ccc(N2CCN(CC(O)COCc3ccco3)CC2)cc1 |
| InChI | InChI=1S/C18H24N2O4/c21-16-5-3-15(4-6-16)20-9-7-19(8-10-20)12-17(22)13-23-14-18-2-1-11-24-18/h1-6,11,17,21-22H,7-10,12-14H2 |
| InChIKey | SRRWSKDJYIUUFT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |