C18H23ClN2O4S2 — CID 18081696
1-[(4-chlorophenyl)methoxy]-3-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-2-ol (PubChem CID 18081696) has the molecular formula C18H23ClN2O4S2 and a molecular weight of 430.98 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methoxy]-3-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-2-ol.
| Compound Name | 1-[(4-chlorophenyl)methoxy]-3-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 18081696 |
| Molecular Formula | C18H23ClN2O4S2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 1-[(4-chlorophenyl)methoxy]-3-(4-thiophen-2-ylsulfonylpiperazin-1-yl)propan-2-ol |
| SMILES | O=S(=O)(c1cccs1)N1CCN(CC(O)COCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H23ClN2O4S2/c19-16-5-3-15(4-6-16)13-25-14-17(22)12-20-7-9-21(10-8-20)27(23,24)18-2-1-11-26-18/h1-6,11,17,22H,7-10,12-14H2 |
| InChIKey | YSFYIVPSDPMVLL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |