C22H28N2O4S — CID 6212489
1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-3-phenylmethoxypropan-2-ol (PubChem CID 6212489) has the molecular formula C22H28N2O4S and a molecular weight of 416.54 g/mol. Its IUPAC name is 1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-3-phenylmethoxypropan-2-ol.
| Compound Name | 1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 6212489 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 1-[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]-3-phenylmethoxypropan-2-ol |
| SMILES | O=S(=O)(/C=C/c1ccccc1)N1CCN(CC(O)COCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H28N2O4S/c25-22(19-28-18-21-9-5-2-6-10-21)17-23-12-14-24(15-13-23)29(26,27)16-11-20-7-3-1-4-8-20/h1-11,16,22,25H,12-15,17-19H2/b16-11+ |
| InChIKey | GOPYWYHMVQOUGZ-LFIBNONCSA-N |
| XLogP | 2.18 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |