C21H27Cl3N2O2-2 — CID 21237584
1-(4-benzylpiperazin-1-yl)-3-[(4-chlorophenyl)methoxy]propan-2-ol dichloride (PubChem CID 21237584) has the molecular formula C21H27Cl3N2O2-2 and a molecular weight of 445.82 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-3-[(4-chlorophenyl)methoxy]propan-2-ol dichloride.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-3-[(4-chlorophenyl)methoxy]propan-2-ol dichloride |
|---|---|
| PubChem CID | 21237584 |
| Molecular Formula | C21H27Cl3N2O2-2 |
| Molecular Weight | 445.82 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-3-[(4-chlorophenyl)methoxy]propan-2-ol dichloride |
| SMILES | OC(COCc1ccc(Cl)cc1)CN1CCN(Cc2ccccc2)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C21H27ClN2O2.2ClH/c22-20-8-6-19(7-9-20)16-26-17-21(25)15-24-12-10-23(11-13-24)14-18-4-2-1-3-5-18;;/h1-9,21,25H,10-17H2;2*1H/p-2 |
| InChIKey | DKAHLZYBFJEXGH-UHFFFAOYSA-L |
| XLogP | -2.96 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.82 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |