C19H32N2O4S — CID 78782762
1-propan-2-yloxy-3-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]propan-2-ol (PubChem CID 78782762) has the molecular formula C19H32N2O4S and a molecular weight of 384.54 g/mol. Its IUPAC name is 1-propan-2-yloxy-3-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]propan-2-ol.
| Compound Name | 1-propan-2-yloxy-3-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 78782762 |
| Molecular Formula | C19H32N2O4S |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-propan-2-yloxy-3-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]propan-2-ol |
| SMILES | CC(C)OCC(O)CN1CCN(S(=O)(=O)c2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C19H32N2O4S/c1-15(2)17-5-7-19(8-6-17)26(23,24)21-11-9-20(10-12-21)13-18(22)14-25-16(3)4/h5-8,15-16,18,22H,9-14H2,1-4H3 |
| InChIKey | DKHIGCNTLLIWFN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |