C21H35N3O4S — CID 9439886
(2S)-1-[4-[4-[(2S)-butan-2-yl]phenyl]sulfonylpiperazin-1-yl]-3-morpholin-4-ylpropan-2-ol (PubChem CID 9439886) has the molecular formula C21H35N3O4S and a molecular weight of 425.60 g/mol. Its IUPAC name is (2S)-1-[4-[4-[(2S)-butan-2-yl]phenyl]sulfonylpiperazin-1-yl]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | (2S)-1-[4-[4-[(2S)-butan-2-yl]phenyl]sulfonylpiperazin-1-yl]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 9439886 |
| Molecular Formula | C21H35N3O4S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | (2S)-1-[4-[4-[(2S)-butan-2-yl]phenyl]sulfonylpiperazin-1-yl]-3-morpholin-4-ylpropan-2-ol |
| SMILES | CC[C@H](C)c1ccc(S(=O)(=O)N2CCN(C[C@H](O)CN3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C21H35N3O4S/c1-3-18(2)19-4-6-21(7-5-19)29(26,27)24-10-8-22(9-11-24)16-20(25)17-23-12-14-28-15-13-23/h4-7,18,20,25H,3,8-17H2,1-2H3/t18-,20-/m0/s1 |
| InChIKey | FJPLGJDUBRILPR-ICSRJNTNSA-N |
| XLogP | 1.20 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |