C19H31N3O5S2 — CID 43011312
3-[2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]ethylsulfonyl]propanamide (PubChem CID 43011312) has the molecular formula C19H31N3O5S2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 3-[2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]ethylsulfonyl]propanamide.
| Compound Name | 3-[2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]ethylsulfonyl]propanamide |
|---|---|
| PubChem CID | 43011312 |
| Molecular Formula | C19H31N3O5S2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 3-[2-[4-(4-butan-2-ylphenyl)sulfonylpiperazin-1-yl]ethylsulfonyl]propanamide |
| SMILES | CCC(C)c1ccc(S(=O)(=O)N2CCN(CCS(=O)(=O)CCC(N)=O)CC2)cc1 |
| InChI | InChI=1S/C19H31N3O5S2/c1-3-16(2)17-4-6-18(7-5-17)29(26,27)22-11-9-21(10-12-22)13-15-28(24,25)14-8-19(20)23/h4-7,16H,3,8-15H2,1-2H3,(H2,20,23) |
| InChIKey | KMSQTSSEAZGKTC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |