C18H24N4O3 — CID 4041027
1-(4-methoxyphenoxy)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-ol (PubChem CID 4041027) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-(4-methoxyphenoxy)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-ol.
| Compound Name | 1-(4-methoxyphenoxy)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 4041027 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-(4-methoxyphenoxy)-3-(4-pyrimidin-2-ylpiperazin-1-yl)propan-2-ol |
| SMILES | COc1ccc(OCC(O)CN2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C18H24N4O3/c1-24-16-3-5-17(6-4-16)25-14-15(23)13-21-9-11-22(12-10-21)18-19-7-2-8-20-18/h2-8,15,23H,9-14H2,1H3 |
| InChIKey | YYFARQJUKVPNNQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |