C19H24N4O4 — CID 52532865
methyl 4-[(2R)-2-hydroxy-3-(4-pyrimidin-2-ylpiperazin-1-yl)propoxy]benzoate (PubChem CID 52532865) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is methyl 4-[(2R)-2-hydroxy-3-(4-pyrimidin-2-ylpiperazin-1-yl)propoxy]benzoate.
| Compound Name | methyl 4-[(2R)-2-hydroxy-3-(4-pyrimidin-2-ylpiperazin-1-yl)propoxy]benzoate |
|---|---|
| PubChem CID | 52532865 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | methyl 4-[(2R)-2-hydroxy-3-(4-pyrimidin-2-ylpiperazin-1-yl)propoxy]benzoate |
| SMILES | COC(=O)c1ccc(OC[C@H](O)CN2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C19H24N4O4/c1-26-18(25)15-3-5-17(6-4-15)27-14-16(24)13-22-9-11-23(12-10-22)19-20-7-2-8-21-19/h2-8,16,24H,9-14H2,1H3/t16-/m1/s1 |
| InChIKey | RDQKWBFOSPIIEH-MRXNPFEDSA-N |
| XLogP | 0.83 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |