C17H27N3O4 — CID 9098126
3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-morpholin-4-ylethyl)propanamide (PubChem CID 9098126) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-morpholin-4-ylethyl)propanamide.
| Compound Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-morpholin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 9098126 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-morpholin-4-ylethyl)propanamide |
| SMILES | O=C(CCN1C(=O)[C@@H]2CCCC[C@H]2C1=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C17H27N3O4/c21-15(18-6-8-19-9-11-24-12-10-19)5-7-20-16(22)13-3-1-2-4-14(13)17(20)23/h13-14H,1-12H2,(H,18,21)/t13-,14-/m1/s1 |
| InChIKey | VQHITWWLBQUJQG-ZIAGYGMSSA-N |
| XLogP | 0.00 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|