C20H31N6O2+ — CID 9452774
(5S,9S)-7,7,9-trimethyl-3-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 9452774) has the molecular formula C20H31N6O2+ and a molecular weight of 387.51 g/mol. Its IUPAC name is (5S,9S)-7,7,9-trimethyl-3-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S,9S)-7,7,9-trimethyl-3-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 9452774 |
| Molecular Formula | C20H31N6O2+ |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | (5S,9S)-7,7,9-trimethyl-3-[(4-pyrimidin-2-ylpiperazin-1-ium-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@H]1CC(C)(C)C[C@]2(C1)NC(=O)N(C[NH+]1CCN(c3ncccn3)CC1)C2=O |
| InChI | InChI=1S/C20H30N6O2/c1-15-11-19(2,3)13-20(12-15)16(27)26(18(28)23-20)14-24-7-9-25(10-8-24)17-21-5-4-6-22-17/h4-6,15H,7-14H2,1-3H3,(H,23,28)/p+1/t15-,20-/m0/s1 |
| InChIKey | IIJPVOYMHJYOHQ-YWZLYKJASA-O |
| XLogP | 0.28 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|