C20H30N6O2 — CID 9452779
(5R,9S)-7,7,9-trimethyl-3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 9452779) has the molecular formula C20H30N6O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is (5R,9S)-7,7,9-trimethyl-3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5R,9S)-7,7,9-trimethyl-3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 9452779 |
| Molecular Formula | C20H30N6O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (5R,9S)-7,7,9-trimethyl-3-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@H]1CC(C)(C)C[C@@]2(C1)NC(=O)N(CN1CCN(c3ncccn3)CC1)C2=O |
| InChI | InChI=1S/C20H30N6O2/c1-15-11-19(2,3)13-20(12-15)16(27)26(18(28)23-20)14-24-7-9-25(10-8-24)17-21-5-4-6-22-17/h4-6,15H,7-14H2,1-3H3,(H,23,28)/t15-,20+/m0/s1 |
| InChIKey | IIJPVOYMHJYOHQ-MGPUTAFESA-N |
| XLogP | 1.69 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|