C19H25ClN2O3 — CID 4855070
3-[2-(2-chlorophenoxy)ethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 4855070) has the molecular formula C19H25ClN2O3 and a molecular weight of 364.87 g/mol. Its IUPAC name is 3-[2-(2-chlorophenoxy)ethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-[2-(2-chlorophenoxy)ethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 4855070 |
| Molecular Formula | C19H25ClN2O3 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 3-[2-(2-chlorophenoxy)ethyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CCOc1ccccc1Cl)C2=O |
| InChI | InChI=1S/C19H25ClN2O3/c1-13-10-18(2,3)12-19(11-13)16(23)22(17(24)21-19)8-9-25-15-7-5-4-6-14(15)20/h4-7,13H,8-12H2,1-3H3,(H,21,24) |
| InChIKey | RXCZVBUCMBUYPA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|