C17H23ClN2O3 — CID 42965848
3-[2-(2-chlorophenoxy)ethyl]-5-methyl-5-(3-methylbutyl)imidazolidine-2,4-dione (PubChem CID 42965848) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is 3-[2-(2-chlorophenoxy)ethyl]-5-methyl-5-(3-methylbutyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-(2-chlorophenoxy)ethyl]-5-methyl-5-(3-methylbutyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42965848 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 3-[2-(2-chlorophenoxy)ethyl]-5-methyl-5-(3-methylbutyl)imidazolidine-2,4-dione |
| SMILES | CC(C)CCC1(C)NC(=O)N(CCOc2ccccc2Cl)C1=O |
| InChI | InChI=1S/C17H23ClN2O3/c1-12(2)8-9-17(3)15(21)20(16(22)19-17)10-11-23-14-7-5-4-6-13(14)18/h4-7,12H,8-11H2,1-3H3,(H,19,22) |
| InChIKey | HRPXOIJIKUVGTD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|