C25H35N5O2S — CID 98449345
(5S,9R)-3-[[4-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 98449345) has the molecular formula C25H35N5O2S and a molecular weight of 469.66 g/mol. Its IUPAC name is (5S,9R)-3-[[4-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S,9R)-3-[[4-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 98449345 |
| Molecular Formula | C25H35N5O2S |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | (5S,9R)-3-[[4-[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]piperazin-1-yl]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@@H]1CC(C)(C)C[C@]2(C1)NC(=O)N(CN1CCN([C@H](C)c3nc4ccccc4s3)CC1)C2=O |
| InChI | InChI=1S/C25H35N5O2S/c1-17-13-24(3,4)15-25(14-17)22(31)30(23(32)27-25)16-28-9-11-29(12-10-28)18(2)21-26-19-7-5-6-8-20(19)33-21/h5-8,17-18H,9-16H2,1-4H3,(H,27,32)/t17-,18-,25+/m1/s1 |
| InChIKey | DRTMKADQNKGQSZ-GAKIBJFNSA-N |
| XLogP | 4.07 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|