C19H25N4O2S+ — CID 9284657
[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-methylazanium (PubChem CID 9284657) has the molecular formula C19H25N4O2S+ and a molecular weight of 373.50 g/mol. Its IUPAC name is [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-methylazanium.
| Compound Name | [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9284657 |
| Molecular Formula | C19H25N4O2S+ |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-[(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)methyl]-methylazanium |
| SMILES | C[C@H](c1nc2ccccc2s1)[NH+](C)CN1C(=O)NC2(CCCCC2)C1=O |
| InChI | InChI=1S/C19H24N4O2S/c1-13(16-20-14-8-4-5-9-15(14)26-16)22(2)12-23-17(24)19(21-18(23)25)10-6-3-7-11-19/h4-5,8-9,13H,3,6-7,10-12H2,1-2H3,(H,21,25)/p+1/t13-/m1/s1 |
| InChIKey | FQJKQRCUBPXMMW-CYBMUJFWSA-O |
| XLogP | 2.08 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|