C18H23N4O3S+ — CID 9284737
[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methyl-[[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]azanium (PubChem CID 9284737) has the molecular formula C18H23N4O3S+ and a molecular weight of 375.47 g/mol. Its IUPAC name is [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methyl-[[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]azanium.
| Compound Name | [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methyl-[[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]azanium |
|---|---|
| PubChem CID | 9284737 |
| Molecular Formula | C18H23N4O3S+ |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methyl-[[3-(2-methylpropyl)-2,4,5-trioxoimidazolidin-1-yl]methyl]azanium |
| SMILES | CC(C)CN1C(=O)C(=O)N(C[NH+](C)[C@H](C)c2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C18H22N4O3S/c1-11(2)9-21-16(23)17(24)22(18(21)25)10-20(4)12(3)15-19-13-7-5-6-8-14(13)26-15/h5-8,11-12H,9-10H2,1-4H3/p+1/t12-/m1/s1 |
| InChIKey | JAWBAUZZRKPRGE-GFCCVEGCSA-O |
| XLogP | 1.28 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|