C21H22N3O2S+ — CID 9284835
[(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-[(5-ethyl-2,3-dioxoindol-1-yl)methyl]-methylazanium (PubChem CID 9284835) has the molecular formula C21H22N3O2S+ and a molecular weight of 380.49 g/mol. Its IUPAC name is [(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-[(5-ethyl-2,3-dioxoindol-1-yl)methyl]-methylazanium.
| Compound Name | [(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-[(5-ethyl-2,3-dioxoindol-1-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9284835 |
| Molecular Formula | C21H22N3O2S+ |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [(1S)-1-(1,3-benzothiazol-2-yl)ethyl]-[(5-ethyl-2,3-dioxoindol-1-yl)methyl]-methylazanium |
| SMILES | CCc1ccc2c(c1)C(=O)C(=O)N2C[NH+](C)[C@@H](C)c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H21N3O2S/c1-4-14-9-10-17-15(11-14)19(25)21(26)24(17)12-23(3)13(2)20-22-16-7-5-6-8-18(16)27-20/h5-11,13H,4,12H2,1-3H3/p+1/t13-/m0/s1 |
| InChIKey | KMJJTSJKFHOSRO-ZDUSSCGKSA-O |
| XLogP | 2.62 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|