C14H20N2O3S2 — CID 8804966
4-[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylazaniumyl]butane-1-sulfonate (PubChem CID 8804966) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 4-[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylazaniumyl]butane-1-sulfonate.
| Compound Name | 4-[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylazaniumyl]butane-1-sulfonate |
|---|---|
| PubChem CID | 8804966 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 4-[[(1R)-1-(1,3-benzothiazol-2-yl)ethyl]-methylazaniumyl]butane-1-sulfonate |
| SMILES | C[C@H](c1nc2ccccc2s1)[NH+](C)CCCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C14H20N2O3S2/c1-11(16(2)9-5-6-10-21(17,18)19)14-15-12-7-3-4-8-13(12)20-14/h3-4,7-8,11H,5-6,9-10H2,1-2H3,(H,17,18,19)/t11-/m1/s1 |
| InChIKey | RYUBIXHOMRXFLV-LLVKDONJSA-N |
| XLogP | 1.20 |
| TPSA | 74.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|