C9H8NO3S3- — CID 3789139
2-(1,3-benzothiazol-2-ylsulfanyl)ethanesulfonate (PubChem CID 3789139) has the molecular formula C9H8NO3S3- and a molecular weight of 274.37 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)ethanesulfonate.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)ethanesulfonate |
|---|---|
| PubChem CID | 3789139 |
| Molecular Formula | C9H8NO3S3- |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)ethanesulfonate |
| SMILES | O=S(=O)([O-])CCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H9NO3S3/c11-16(12,13)6-5-14-9-10-7-3-1-2-4-8(7)15-9/h1-4H,5-6H2,(H,11,12,13)/p-1 |
| InChIKey | XZFJLUPWIGQXBU-UHFFFAOYSA-M |
| XLogP | 1.93 |
| TPSA | 70.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|