C11H13NOS3 — CID 847090
2-(2-ethylsulfinylethylsulfanyl)-1,3-benzothiazole (PubChem CID 847090) has the molecular formula C11H13NOS3 and a molecular weight of 271.43 g/mol. Its IUPAC name is 2-(2-ethylsulfinylethylsulfanyl)-1,3-benzothiazole.
| Compound Name | 2-(2-ethylsulfinylethylsulfanyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 847090 |
| Molecular Formula | C11H13NOS3 |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 2-(2-ethylsulfinylethylsulfanyl)-1,3-benzothiazole |
| SMILES | CCS(=O)CCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H13NOS3/c1-2-16(13)8-7-14-11-12-9-5-3-4-6-10(9)15-11/h3-6H,2,7-8H2,1H3 |
| InChIKey | DKLSMZXWXJFQGO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |