C12H13NS2 — CID 118036989
2-(2-methylidenebutylsulfanyl)-1,3-benzothiazole (PubChem CID 118036989) has the molecular formula C12H13NS2 and a molecular weight of 235.38 g/mol. Its IUPAC name is 2-(2-methylidenebutylsulfanyl)-1,3-benzothiazole.
| Compound Name | 2-(2-methylidenebutylsulfanyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 118036989 |
| Molecular Formula | C12H13NS2 |
| Molecular Weight | 235.38 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 2-(2-methylidenebutylsulfanyl)-1,3-benzothiazole |
| SMILES | C=C(CC)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H13NS2/c1-3-9(2)8-14-12-13-10-6-4-5-7-11(10)15-12/h4-7H,2-3,8H2,1H3 |
| InChIKey | JXVNWFOOHBFYOI-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|