C8H7NS3 — CID 18616061
1,3-benzothiazol-2-ylsulfanylmethanethiol (PubChem CID 18616061) has the molecular formula C8H7NS3 and a molecular weight of 213.35 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylsulfanylmethanethiol.
| Compound Name | 1,3-benzothiazol-2-ylsulfanylmethanethiol |
|---|---|
| PubChem CID | 18616061 |
| Molecular Formula | C8H7NS3 |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 212.97 |
| IUPAC Name | 1,3-benzothiazol-2-ylsulfanylmethanethiol |
| SMILES | SCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C8H7NS3/c10-5-11-8-9-6-3-1-2-4-7(6)12-8/h1-4,10H,5H2 |
| InChIKey | VYAZJJPXGHNCQV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|