C7H6N2S3 — CID 123894095
[1,3]thiazolo[5,4-c]pyridin-2-ylsulfanylmethanethiol (PubChem CID 123894095) has the molecular formula C7H6N2S3 and a molecular weight of 214.34 g/mol. Its IUPAC name is [1,3]thiazolo[5,4-c]pyridin-2-ylsulfanylmethanethiol.
| Compound Name | [1,3]thiazolo[5,4-c]pyridin-2-ylsulfanylmethanethiol |
|---|---|
| PubChem CID | 123894095 |
| Molecular Formula | C7H6N2S3 |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 213.97 |
| IUPAC Name | [1,3]thiazolo[5,4-c]pyridin-2-ylsulfanylmethanethiol |
| SMILES | SCSc1nc2ccncc2s1 |
| InChI | InChI=1S/C7H6N2S3/c10-4-11-7-9-5-1-2-8-3-6(5)12-7/h1-3,10H,4H2 |
| InChIKey | IFBQKJNGKJPPQK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|