C13H10N2S — CID 86182025
2-(4-methylphenyl)-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 86182025) has the molecular formula C13H10N2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-(4-methylphenyl)-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | 2-(4-methylphenyl)-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 86182025 |
| Molecular Formula | C13H10N2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-(4-methylphenyl)-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | Cc1ccc(-c2nc3ccncc3s2)cc1 |
| InChI | InChI=1S/C13H10N2S/c1-9-2-4-10(5-3-9)13-15-11-6-7-14-8-12(11)16-13/h2-8H,1H3 |
| InChIKey | JZZQHJXRXNRPRH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |