C9H6N2OS2 — CID 13168236
2-(isocyanatomethylsulfanyl)-1,3-benzothiazole (PubChem CID 13168236) has the molecular formula C9H6N2OS2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 2-(isocyanatomethylsulfanyl)-1,3-benzothiazole.
| Compound Name | 2-(isocyanatomethylsulfanyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 13168236 |
| Molecular Formula | C9H6N2OS2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 2-(isocyanatomethylsulfanyl)-1,3-benzothiazole |
| SMILES | O=C=NCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H6N2OS2/c12-5-10-6-13-9-11-7-3-1-2-4-8(7)14-9/h1-4H,6H2 |
| InChIKey | SGVINURPXZYECK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|