C20H16N2O3S4 — CID 88662878
3-(1,3-benzothiazol-2-ylsulfanyl)propanoyl 3-(1,3-benzothiazol-2-ylsulfanyl)propanoate (PubChem CID 88662878) has the molecular formula C20H16N2O3S4 and a molecular weight of 460.63 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanyl)propanoyl 3-(1,3-benzothiazol-2-ylsulfanyl)propanoate.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanyl)propanoyl 3-(1,3-benzothiazol-2-ylsulfanyl)propanoate |
|---|---|
| PubChem CID | 88662878 |
| Molecular Formula | C20H16N2O3S4 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.00 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanyl)propanoyl 3-(1,3-benzothiazol-2-ylsulfanyl)propanoate |
| SMILES | O=C(CCSc1nc2ccccc2s1)OC(=O)CCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H16N2O3S4/c23-17(9-11-26-19-21-13-5-1-3-7-15(13)28-19)25-18(24)10-12-27-20-22-14-6-2-4-8-16(14)29-20/h1-8H,9-12H2 |
| InChIKey | DQLRDVMSRWMWRL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|