C16H12NO2S3- — CID 7040361
2-[2-(1,3-benzothiazol-2-ylsulfanyl)ethylsulfanyl]benzoate (PubChem CID 7040361) has the molecular formula C16H12NO2S3- and a molecular weight of 346.48 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-2-ylsulfanyl)ethylsulfanyl]benzoate.
| Compound Name | 2-[2-(1,3-benzothiazol-2-ylsulfanyl)ethylsulfanyl]benzoate |
|---|---|
| PubChem CID | 7040361 |
| Molecular Formula | C16H12NO2S3- |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-2-ylsulfanyl)ethylsulfanyl]benzoate |
| SMILES | O=C([O-])c1ccccc1SCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H13NO2S3/c18-15(19)11-5-1-3-7-13(11)20-9-10-21-16-17-12-6-2-4-8-14(12)22-16/h1-8H,9-10H2,(H,18,19)/p-1 |
| InChIKey | GMIJBNSUKIIZGG-UHFFFAOYSA-M |
| XLogP | 3.54 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|