C12H12ClNO2S2 — CID 156786686
3-(1,3-benzothiazol-2-ylsulfanyl)propyl 2-chloroacetate (PubChem CID 156786686) has the molecular formula C12H12ClNO2S2 and a molecular weight of 301.82 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanyl)propyl 2-chloroacetate.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanyl)propyl 2-chloroacetate |
|---|---|
| PubChem CID | 156786686 |
| Molecular Formula | C12H12ClNO2S2 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanyl)propyl 2-chloroacetate |
| SMILES | O=C(CCl)OCCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H12ClNO2S2/c13-8-11(15)16-6-3-7-17-12-14-9-4-1-2-5-10(9)18-12/h1-2,4-5H,3,6-8H2 |
| InChIKey | SEJPHKFATYCLIC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|