C16H14N2O2S2 — CID 2731993
2-(1,3-benzothiazol-2-ylsulfanyl)ethyl N-phenylcarbamate (PubChem CID 2731993) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)ethyl N-phenylcarbamate.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)ethyl N-phenylcarbamate |
|---|---|
| PubChem CID | 2731993 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)ethyl N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)OCCSc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H14N2O2S2/c19-15(17-12-6-2-1-3-7-12)20-10-11-21-16-18-13-8-4-5-9-14(13)22-16/h1-9H,10-11H2,(H,17,19) |
| InChIKey | QXYJGEQGDHJLMO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|