C20H20N2O3S2 — CID 7191466
[(2S)-1-anilino-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate (PubChem CID 7191466) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is [(2S)-1-anilino-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate.
| Compound Name | [(2S)-1-anilino-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate |
|---|---|
| PubChem CID | 7191466 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [(2S)-1-anilino-1-oxopropan-2-yl] 4-(1,3-benzothiazol-2-ylsulfanyl)butanoate |
| SMILES | C[C@H](OC(=O)CCCSc1nc2ccccc2s1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H20N2O3S2/c1-14(19(24)21-15-8-3-2-4-9-15)25-18(23)12-7-13-26-20-22-16-10-5-6-11-17(16)27-20/h2-6,8-11,14H,7,12-13H2,1H3,(H,21,24)/t14-/m0/s1 |
| InChIKey | QQSYBDDTNRZQBZ-AWEZNQCLSA-N |
| XLogP | 4.74 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|