C13H10N2OS2 — CID 21179246
1-(1,3-benzothiazol-2-ylsulfanylmethyl)pyridin-2-one (PubChem CID 21179246) has the molecular formula C13H10N2OS2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylsulfanylmethyl)pyridin-2-one.
| Compound Name | 1-(1,3-benzothiazol-2-ylsulfanylmethyl)pyridin-2-one |
|---|---|
| PubChem CID | 21179246 |
| Molecular Formula | C13H10N2OS2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylsulfanylmethyl)pyridin-2-one |
| SMILES | O=c1ccccn1CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H10N2OS2/c16-12-7-3-4-8-15(12)9-17-13-14-10-5-1-2-6-11(10)18-13/h1-8H,9H2 |
| InChIKey | DIEWTVNPLFOUAM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |