C16H14N2O3S2 — CID 98526108
(3aR,4S,7S,7aR)-2-(1,3-benzothiazol-2-ylsulfanylmethyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 98526108) has the molecular formula C16H14N2O3S2 and a molecular weight of 346.43 g/mol. Its IUPAC name is (3aR,4S,7S,7aR)-2-(1,3-benzothiazol-2-ylsulfanylmethyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4S,7S,7aR)-2-(1,3-benzothiazol-2-ylsulfanylmethyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 98526108 |
| Molecular Formula | C16H14N2O3S2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | (3aR,4S,7S,7aR)-2-(1,3-benzothiazol-2-ylsulfanylmethyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1CSc1nc3ccccc3s1)[C@@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C16H14N2O3S2/c19-14-12-9-5-6-10(21-9)13(12)15(20)18(14)7-22-16-17-8-3-1-2-4-11(8)23-16/h1-4,9-10,12-13H,5-7H2/t9-,10-,12-,13-/m0/s1 |
| InChIKey | UCDGZMAOQKPZJK-UKJIMTQDSA-N |
| XLogP | 2.51 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|