C13H17NOS2 — CID 100985330
(2R)-1-(1,3-benzothiazol-2-ylsulfanyl)hexan-2-ol (PubChem CID 100985330) has the molecular formula C13H17NOS2 and a molecular weight of 267.42 g/mol. Its IUPAC name is (2R)-1-(1,3-benzothiazol-2-ylsulfanyl)hexan-2-ol.
| Compound Name | (2R)-1-(1,3-benzothiazol-2-ylsulfanyl)hexan-2-ol |
|---|---|
| PubChem CID | 100985330 |
| Molecular Formula | C13H17NOS2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | (2R)-1-(1,3-benzothiazol-2-ylsulfanyl)hexan-2-ol |
| SMILES | CCCC[C@@H](O)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C13H17NOS2/c1-2-3-6-10(15)9-16-13-14-11-7-4-5-8-12(11)17-13/h4-5,7-8,10,15H,2-3,6,9H2,1H3/t10-/m1/s1 |
| InChIKey | AWLTUPDQWNXQGK-SNVBAGLBSA-N |
| XLogP | 3.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |