C26H39N2O4S3+ — CID 126960830
[3-(1,3-benzothiazol-2-ylsulfanyl)-2-hydroxypropyl]-dibutyl-methylazanium;4-methylbenzenesulfonic acid (PubChem CID 126960830) has the molecular formula C26H39N2O4S3+ and a molecular weight of 539.81 g/mol. Its IUPAC name is [3-(1,3-benzothiazol-2-ylsulfanyl)-2-hydroxypropyl]-dibutyl-methylazanium;4-methylbenzenesulfonic acid.
| Compound Name | [3-(1,3-benzothiazol-2-ylsulfanyl)-2-hydroxypropyl]-dibutyl-methylazanium;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 126960830 |
| Molecular Formula | C26H39N2O4S3+ |
| Molecular Weight | 539.81 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | [3-(1,3-benzothiazol-2-ylsulfanyl)-2-hydroxypropyl]-dibutyl-methylazanium;4-methylbenzenesulfonic acid |
| SMILES | CCCC[N+](C)(CCCC)CC(O)CSc1nc2ccccc2s1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C19H31N2OS2.C7H8O3S/c1-4-6-12-21(3,13-7-5-2)14-16(22)15-23-19-20-17-10-8-9-11-18(17)24-19;1-6-2-4-7(5-3-6)11(8,9)10/h8-11,16,22H,4-7,12-15H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1; |
| InChIKey | BQMFEWHKRIAFPX-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.81 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|