C19H31N2OS2+ — CID 3387568
[3-(1,3-benzothiazol-2-ylsulfanyl)-2-hydroxypropyl]-dibutyl-methylazanium (PubChem CID 3387568) has the molecular formula C19H31N2OS2+ and a molecular weight of 367.60 g/mol. Its IUPAC name is [3-(1,3-benzothiazol-2-ylsulfanyl)-2-hydroxypropyl]-dibutyl-methylazanium.
| Compound Name | [3-(1,3-benzothiazol-2-ylsulfanyl)-2-hydroxypropyl]-dibutyl-methylazanium |
|---|---|
| PubChem CID | 3387568 |
| Molecular Formula | C19H31N2OS2+ |
| Molecular Weight | 367.60 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | [3-(1,3-benzothiazol-2-ylsulfanyl)-2-hydroxypropyl]-dibutyl-methylazanium |
| SMILES | CCCC[N+](C)(CCCC)CC(O)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H31N2OS2/c1-4-6-12-21(3,13-7-5-2)14-16(22)15-23-19-20-17-10-8-9-11-18(17)24-19/h8-11,16,22H,4-7,12-15H2,1-3H3/q+1 |
| InChIKey | BFKUJTKIALPKDP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|