C10H8INS3 — CID 54053495
3-(1,3-benzothiazol-2-ylsulfanyl)-2-iodopropanethial (PubChem CID 54053495) has the molecular formula C10H8INS3 and a molecular weight of 365.29 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanyl)-2-iodopropanethial.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-2-iodopropanethial |
|---|---|
| PubChem CID | 54053495 |
| Molecular Formula | C10H8INS3 |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.89 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-2-iodopropanethial |
| SMILES | S=CC(I)CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C10H8INS3/c11-7(5-13)6-14-10-12-8-3-1-2-4-9(8)15-10/h1-5,7H,6H2 |
| InChIKey | TZKGKKFTBMPGCP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|