C54H45BN6O3S12 — CID 141352310
tris[3-(1,3-benzothiazol-2-ylsulfanyl)-2-(1,3-benzothiazol-2-ylsulfanylmethyl)propyl] borate (PubChem CID 141352310) has the molecular formula C54H45BN6O3S12 and a molecular weight of 1221.61 g/mol. Its IUPAC name is tris[3-(1,3-benzothiazol-2-ylsulfanyl)-2-(1,3-benzothiazol-2-ylsulfanylmethyl)propyl] borate.
| Compound Name | tris[3-(1,3-benzothiazol-2-ylsulfanyl)-2-(1,3-benzothiazol-2-ylsulfanylmethyl)propyl] borate |
|---|---|
| PubChem CID | 141352310 |
| Molecular Formula | C54H45BN6O3S12 |
| Molecular Weight | 1221.61 g/mol |
| Exact Mass | 1220.03 |
| IUPAC Name | tris[3-(1,3-benzothiazol-2-ylsulfanyl)-2-(1,3-benzothiazol-2-ylsulfanylmethyl)propyl] borate |
| SMILES | c1ccc2sc(SCC(COB(OCC(CSc3nc4ccccc4s3)CSc3nc4ccccc4s3)OCC(CSc3nc4ccccc4s3)CSc3nc4ccccc4s3)CSc3nc4ccccc4s3)nc2c1 |
| InChI | InChI=1S/C54H45BN6O3S12/c1-7-19-43-37(13-1)56-49(71-43)65-28-34(29-66-50-57-38-14-2-8-20-44(38)72-50)25-62-55(63-26-35(30-67-51-58-39-15-3-9-21-45(39)73-51)31-68-52-59-40-16-4-10-22-46(40)74-52)64-27-36(32-69-53-60-41-17-5-11-23-47(41)75-53)33-70-54-61-42-18-6-12-24-48(42)76-54/h1-24,34-36H,25-33H2 |
| InChIKey | UMXFOMMCBFTVIE-UHFFFAOYSA-N |
| XLogP | 17.28 |
| TPSA | 105.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1221.61 |
| LogP ≤ 5 | 17.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|