C12H14N2O3S2 — CID 142014858
2-amino-5-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxypentanoic acid (PubChem CID 142014858) has the molecular formula C12H14N2O3S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-amino-5-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxypentanoic acid.
| Compound Name | 2-amino-5-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxypentanoic acid |
|---|---|
| PubChem CID | 142014858 |
| Molecular Formula | C12H14N2O3S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2-amino-5-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxypentanoic acid |
| SMILES | NC(CC(O)CSc1nc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C12H14N2O3S2/c13-8(11(16)17)5-7(15)6-18-12-14-9-3-1-2-4-10(9)19-12/h1-4,7-8,15H,5-6,13H2,(H,16,17) |
| InChIKey | LAAUQHNCWUKMRB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |